| Name | 2,4-diaminophenol dihydrochloride |
| Synonyms | nci-c60026 2,4-Diaminophenol 2HCL 2,4-DIAMINOPHENOL 2HCL 2,4-DIAMINOPHENOL HYDROCHLORIDE 2,4-diaminophenol dihydrochloride 2,4-DIAMINOPHENOL DIHYDROCHLORIDE phenol,2,4-diamino-dihydrochloride Phenol,2,4-diamino-,dihydrochloride 1-HYDROXYBENZENE-2,4-DIAMMONIUM DICHLORIDE 4-HYDROXY-M-PHENYLENEDIAMINE DIHYDROCHLORIDE |
| CAS | 137-09-7 |
| EINECS | 205-279-4 |
| InChI | InChI=1/C6H8N2O.ClH/c7-4-1-2-6(9)5(8)3-4;/h1-3,9H,7-8H2;1H |
| Molecular Formula | C6H10Cl2N2O |
| Molar Mass | 197.06 |
| Density | 1.3457 (rough estimate) |
| Melting Point | 222°C (dec.)(lit.) |
| Boling Point | 347.4°C at 760 mmHg |
| Flash Point | 163.9°C |
| Water Solubility | 27.5 g/100 mL (15 ºC) |
| Solubility | 275g/l |
| Vapor Presure | 2.68E-05mmHg at 25°C |
| Appearance | Green crystalline powder |
| Color | Beige to gray-green |
| Merck | 14,2983 |
| BRN | 3913728 |
| PH | 1-2 (50g/l, H2O, 20℃) |
| Storage Condition | Store below +30°C. |
| Stability | Stable. Incompatible with strong oxidizing agents, acids. Heat and light sensitive. |
| Refractive Index | 1.5680 (estimate) |
| MDL | MFCD00012979 |
| Physical and Chemical Properties | Colorless or off-white needle-like crystals. Soluble in water, slightly soluble in ethanol. Decomposition without melting when heated. |
| Use | They are used as imaging agents and fur dyes, and as chemical reagents. |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SK7600000 |
| TSCA | Yes |
| HS Code | 29222900 |
| Hazard Class | 6.1 |
| Packing Group | III |
| Toxicity | LD50 orally in Rabbit: 240 mg/kg |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used as a developer and fur dye, and as a chemical reagent. |
| production method | from 2,4 dinitrophenol reduction |
| category | toxic substances |
| toxicity classification | highly toxic |
| acute toxicity | abdominal cavity-mouse LDL0: 50 mg/kg |
| flammability hazard characteristics | combustible; combustion produces toxic nitrogen oxides and hydrogen chloride smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |